C19H23F3N4O — CID 133450635
N-[1-ethyl-2-(3,4,5-trifluorophenyl)pyrrolidin-3-yl]-2-(methoxymethyl)-6-methylpyrimidin-4-amine (PubChem CID 133450635) has the molecular formula C19H23F3N4O and a molecular weight of 380.41 g/mol. Its IUPAC name is N-[1-ethyl-2-(3,4,5-trifluorophenyl)pyrrolidin-3-yl]-2-(methoxymethyl)-6-methylpyrimidin-4-amine.
| Compound Name | N-[1-ethyl-2-(3,4,5-trifluorophenyl)pyrrolidin-3-yl]-2-(methoxymethyl)-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133450635 |
| Molecular Formula | C19H23F3N4O |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-[1-ethyl-2-(3,4,5-trifluorophenyl)pyrrolidin-3-yl]-2-(methoxymethyl)-6-methylpyrimidin-4-amine |
| SMILES | CCN1CCC(Nc2cc(C)nc(COC)n2)C1c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C19H23F3N4O/c1-4-26-6-5-15(19(26)12-8-13(20)18(22)14(21)9-12)24-16-7-11(2)23-17(25-16)10-27-3/h7-9,15,19H,4-6,10H2,1-3H3,(H,23,24,25) |
| InChIKey | BKIWXYJNAZINIM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|