C18H17F3N4 — CID 133450651
6-[[1-ethyl-2-(3,4,5-trifluorophenyl)pyrrolidin-3-yl]amino]pyridine-3-carbonitrile (PubChem CID 133450651) has the molecular formula C18H17F3N4 and a molecular weight of 346.36 g/mol. Its IUPAC name is 6-[[1-ethyl-2-(3,4,5-trifluorophenyl)pyrrolidin-3-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 6-[[1-ethyl-2-(3,4,5-trifluorophenyl)pyrrolidin-3-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133450651 |
| Molecular Formula | C18H17F3N4 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 6-[[1-ethyl-2-(3,4,5-trifluorophenyl)pyrrolidin-3-yl]amino]pyridine-3-carbonitrile |
| SMILES | CCN1CCC(Nc2ccc(C#N)cn2)C1c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C18H17F3N4/c1-2-25-6-5-15(24-16-4-3-11(9-22)10-23-16)18(25)12-7-13(19)17(21)14(20)8-12/h3-4,7-8,10,15,18H,2,5-6H2,1H3,(H,23,24) |
| InChIKey | DJYGRGQSYGUOBI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|