C13H14ClF3N6 — CID 133450762
4-chloro-6-[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]pyrimidin-2-amine (PubChem CID 133450762) has the molecular formula C13H14ClF3N6 and a molecular weight of 346.74 g/mol. Its IUPAC name is 4-chloro-6-[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]pyrimidin-2-amine.
| Compound Name | 4-chloro-6-[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 133450762 |
| Molecular Formula | C13H14ClF3N6 |
| Molecular Weight | 346.74 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 4-chloro-6-[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]pyrimidin-2-amine |
| SMILES | Nc1nc(Cl)cc(N2CCCC(n3ccc(C(F)(F)F)n3)C2)n1 |
| InChI | InChI=1S/C13H14ClF3N6/c14-10-6-11(20-12(18)19-10)22-4-1-2-8(7-22)23-5-3-9(21-23)13(15,16)17/h3,5-6,8H,1-2,4,7H2,(H2,18,19,20) |
| InChIKey | DYYZDVUZKMJDSF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.74 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |