About [1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpiperidin-3-yl]methanol
[1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpiperidin-3-yl]methanol (PubChem CID 133451629) has the molecular formula C16H19ClN2OS
and a molecular weight of 322.86 g/mol. Its IUPAC name is [1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpiperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpiperidin-3-yl]methanol |
| PubChem CID | 133451629 |
| Molecular Formula | C16H19ClN2OS |
| Molecular Weight | 322.86 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | [1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpiperidin-3-yl]methanol |
| SMILES | CC1(CO)CCCN(c2nc(-c3ccccc3Cl)cs2)C1 |
| InChI | InChI=1S/C16H19ClN2OS/c1-16(11-20)7-4-8-19(10-16)15-18-14(9-21-15)12-5-2-3-6-13(12)17/h2-3,5-6,9,20H,4,7-8,10-11H2,1H3 |
| InChIKey | GMFVSWMSETWIGG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.86 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpiperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpiperidin-3-yl]methanol?
The IUPAC name of [1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpiperidin-3-yl]methanol (CID 133451629) is [1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpiperidin-3-yl]methanol.
What is the SMILES notation for [1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpiperidin-3-yl]methanol?
The canonical SMILES for [1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpiperidin-3-yl]methanol is CC1(CO)CCCN(c2nc(-c3ccccc3Cl)cs2)C1.
What is the InChIKey of [1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpiperidin-3-yl]methanol?
The InChIKey is GMFVSWMSETWIGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN2OS/c1-16(11-20)7-4-8-19(10-16)15-18-14(9-21-15)12-5-2-3-6-13(12)17/h2-3,5-6,9,20H,4,7-8,10-11H2,1H3.
What are the key properties of [1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpiperidin-3-yl]methanol?
[1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpiperidin-3-yl]methanol has a molecular weight of 322.86 g/mol, XLogP of 4.06, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpiperidin-3-yl]methanol is sourced from PubChem (CID 133451629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).