About (2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)methanol
(2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)methanol (PubChem CID 13345225) has the molecular formula C8H9N5O
and a molecular weight of 191.19 g/mol. Its IUPAC name is (2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)methanol.
Molecular Properties
| Compound Name | (2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)methanol |
| PubChem CID | 13345225 |
| Molecular Formula | C8H9N5O |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | (2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)methanol |
| SMILES | Nc1nc(N)c2nc(CO)ccc2n1 |
| InChI | InChI=1S/C8H9N5O/c9-7-6-5(12-8(10)13-7)2-1-4(3-14)11-6/h1-2,14H,3H2,(H4,9,10,12,13) |
| InChIKey | DWQQOTZSMJSANF-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)methanol?
The IUPAC name of (2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)methanol (CID 13345225) is (2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)methanol.
What is the SMILES notation for (2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)methanol?
The canonical SMILES for (2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)methanol is Nc1nc(N)c2nc(CO)ccc2n1.
What is the InChIKey of (2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)methanol?
The InChIKey is DWQQOTZSMJSANF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5O/c9-7-6-5(12-8(10)13-7)2-1-4(3-14)11-6/h1-2,14H,3H2,(H4,9,10,12,13).
What are the key properties of (2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)methanol?
(2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)methanol has a molecular weight of 191.19 g/mol, XLogP of -0.32, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)methanol is sourced from PubChem (CID 13345225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).