C13H16BrN7O2 — CID 133452417
1-(3-bromo-5-nitro-4-pyridinyl)-4-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperazine (PubChem CID 133452417) has the molecular formula C13H16BrN7O2 and a molecular weight of 382.22 g/mol. Its IUPAC name is 1-(3-bromo-5-nitro-4-pyridinyl)-4-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperazine.
| Compound Name | 1-(3-bromo-5-nitro-4-pyridinyl)-4-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperazine |
|---|---|
| PubChem CID | 133452417 |
| Molecular Formula | C13H16BrN7O2 |
| Molecular Weight | 382.22 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 1-(3-bromo-5-nitro-4-pyridinyl)-4-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperazine |
| SMILES | Cc1nc(CN2CCN(c3c(Br)cncc3[N+](=O)[O-])CC2)n[nH]1 |
| InChI | InChI=1S/C13H16BrN7O2/c1-9-16-12(18-17-9)8-19-2-4-20(5-3-19)13-10(14)6-15-7-11(13)21(22)23/h6-7H,2-5,8H2,1H3,(H,16,17,18) |
| InChIKey | SMBOJWWWJZGJRZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|