C15H17F3N4O2S — CID 133453591
4-[3-(1H-imidazol-2-yl)piperidin-1-yl]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 133453591) has the molecular formula C15H17F3N4O2S and a molecular weight of 374.39 g/mol. Its IUPAC name is 4-[3-(1H-imidazol-2-yl)piperidin-1-yl]-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-[3-(1H-imidazol-2-yl)piperidin-1-yl]-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 133453591 |
| Molecular Formula | C15H17F3N4O2S |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 4-[3-(1H-imidazol-2-yl)piperidin-1-yl]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2CCCC(c3ncc[nH]3)C2)cc1C(F)(F)F |
| InChI | InChI=1S/C15H17F3N4O2S/c16-15(17,18)12-8-11(3-4-13(12)25(19,23)24)22-7-1-2-10(9-22)14-20-5-6-21-14/h3-6,8,10H,1-2,7,9H2,(H,20,21)(H2,19,23,24) |
| InChIKey | MAMRVUMMLMMKSH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |