C16H15N5O4S — CID 133454757
3-[(4-imidazol-1-ylphenyl)methylamino]-2-nitrobenzenesulfonamide (PubChem CID 133454757) has the molecular formula C16H15N5O4S and a molecular weight of 373.39 g/mol. Its IUPAC name is 3-[(4-imidazol-1-ylphenyl)methylamino]-2-nitrobenzenesulfonamide.
| Compound Name | 3-[(4-imidazol-1-ylphenyl)methylamino]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133454757 |
| Molecular Formula | C16H15N5O4S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 3-[(4-imidazol-1-ylphenyl)methylamino]-2-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(NCc2ccc(-n3ccnc3)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15N5O4S/c17-26(24,25)15-3-1-2-14(16(15)21(22)23)19-10-12-4-6-13(7-5-12)20-9-8-18-11-20/h1-9,11,19H,10H2,(H2,17,24,25) |
| InChIKey | RKMLFNIOMKKSLV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|