C16H18FN5S — CID 133457420
5-[(4-fluorophenyl)methyl]-N-[3-(1-methylpyrazol-4-yl)propyl]-1,3,4-thiadiazol-2-amine (PubChem CID 133457420) has the molecular formula C16H18FN5S and a molecular weight of 331.42 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methyl]-N-[3-(1-methylpyrazol-4-yl)propyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(4-fluorophenyl)methyl]-N-[3-(1-methylpyrazol-4-yl)propyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 133457420 |
| Molecular Formula | C16H18FN5S |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 5-[(4-fluorophenyl)methyl]-N-[3-(1-methylpyrazol-4-yl)propyl]-1,3,4-thiadiazol-2-amine |
| SMILES | Cn1cc(CCCNc2nnc(Cc3ccc(F)cc3)s2)cn1 |
| InChI | InChI=1S/C16H18FN5S/c1-22-11-13(10-19-22)3-2-8-18-16-21-20-15(23-16)9-12-4-6-14(17)7-5-12/h4-7,10-11H,2-3,8-9H2,1H3,(H,18,21) |
| InChIKey | QMONBAWNZFNXJQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|