C17H19FN6S — CID 133457740
N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-amine (PubChem CID 133457740) has the molecular formula C17H19FN6S and a molecular weight of 358.45 g/mol. Its IUPAC name is N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 133457740 |
| Molecular Formula | C17H19FN6S |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-amine |
| SMILES | CCc1nc2n(n1)CC(Nc1nnc(Cc3ccc(F)cc3)s1)CC2 |
| InChI | InChI=1S/C17H19FN6S/c1-2-14-20-15-8-7-13(10-24(15)23-14)19-17-22-21-16(25-17)9-11-3-5-12(18)6-4-11/h3-6,13H,2,7-10H2,1H3,(H,19,22) |
| InChIKey | PTPVBAQFQUEXOE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |