C12H15BrN2O4 — CID 133459032
4-bromo-N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-2-nitroaniline (PubChem CID 133459032) has the molecular formula C12H15BrN2O4 and a molecular weight of 331.17 g/mol. Its IUPAC name is 4-bromo-N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-2-nitroaniline.
| Compound Name | 4-bromo-N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-2-nitroaniline |
|---|---|
| PubChem CID | 133459032 |
| Molecular Formula | C12H15BrN2O4 |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 4-bromo-N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-2-nitroaniline |
| SMILES | CC1(CCNc2ccc(Br)cc2[N+](=O)[O-])OCCO1 |
| InChI | InChI=1S/C12H15BrN2O4/c1-12(18-6-7-19-12)4-5-14-10-3-2-9(13)8-11(10)15(16)17/h2-3,8,14H,4-7H2,1H3 |
| InChIKey | DMHQVZKKFWYHBV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|