C20H18BrN3O2 — CID 133460234
methyl 6-[[(8-bromoquinolin-2-yl)amino]methyl]-2-cyclopropylpyridine-3-carboxylate (PubChem CID 133460234) has the molecular formula C20H18BrN3O2 and a molecular weight of 412.29 g/mol. Its IUPAC name is methyl 6-[[(8-bromoquinolin-2-yl)amino]methyl]-2-cyclopropylpyridine-3-carboxylate.
| Compound Name | methyl 6-[[(8-bromoquinolin-2-yl)amino]methyl]-2-cyclopropylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 133460234 |
| Molecular Formula | C20H18BrN3O2 |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | methyl 6-[[(8-bromoquinolin-2-yl)amino]methyl]-2-cyclopropylpyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(CNc2ccc3cccc(Br)c3n2)nc1C1CC1 |
| InChI | InChI=1S/C20H18BrN3O2/c1-26-20(25)15-9-8-14(23-18(15)13-5-6-13)11-22-17-10-7-12-3-2-4-16(21)19(12)24-17/h2-4,7-10,13H,5-6,11H2,1H3,(H,22,24) |
| InChIKey | UNCRGUDXPIPBKD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |