C16H15ClN4O4 — CID 133460264
methyl 6-[[(3-chloro-5-nitro-2-pyridinyl)amino]methyl]-2-cyclopropylpyridine-3-carboxylate (PubChem CID 133460264) has the molecular formula C16H15ClN4O4 and a molecular weight of 362.77 g/mol. Its IUPAC name is methyl 6-[[(3-chloro-5-nitro-2-pyridinyl)amino]methyl]-2-cyclopropylpyridine-3-carboxylate.
| Compound Name | methyl 6-[[(3-chloro-5-nitro-2-pyridinyl)amino]methyl]-2-cyclopropylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 133460264 |
| Molecular Formula | C16H15ClN4O4 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | methyl 6-[[(3-chloro-5-nitro-2-pyridinyl)amino]methyl]-2-cyclopropylpyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(CNc2ncc([N+](=O)[O-])cc2Cl)nc1C1CC1 |
| InChI | InChI=1S/C16H15ClN4O4/c1-25-16(22)12-5-4-10(20-14(12)9-2-3-9)7-18-15-13(17)6-11(8-19-15)21(23)24/h4-6,8-9H,2-3,7H2,1H3,(H,18,19) |
| InChIKey | WLPWQIXIWPQHEY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|