C17H20N6O — CID 133460307
6-[[2-(dimethylamino)pyrimidin-5-yl]methyl-methylamino]-N-prop-2-ynylpyridine-3-carboxamide (PubChem CID 133460307) has the molecular formula C17H20N6O and a molecular weight of 324.39 g/mol. Its IUPAC name is 6-[[2-(dimethylamino)pyrimidin-5-yl]methyl-methylamino]-N-prop-2-ynylpyridine-3-carboxamide.
| Compound Name | 6-[[2-(dimethylamino)pyrimidin-5-yl]methyl-methylamino]-N-prop-2-ynylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 133460307 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 6-[[2-(dimethylamino)pyrimidin-5-yl]methyl-methylamino]-N-prop-2-ynylpyridine-3-carboxamide |
| SMILES | C#CCNC(=O)c1ccc(N(C)Cc2cnc(N(C)C)nc2)nc1 |
| InChI | InChI=1S/C17H20N6O/c1-5-8-18-16(24)14-6-7-15(19-11-14)23(4)12-13-9-20-17(21-10-13)22(2)3/h1,6-7,9-11H,8,12H2,2-4H3,(H,18,24) |
| InChIKey | FDPQYEDJUHKMMH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|