About 6-ethyl-N,2-dimethyl-N-(pyrazin-2-ylmethyl)pyrimidin-4-amine
6-ethyl-N,2-dimethyl-N-(pyrazin-2-ylmethyl)pyrimidin-4-amine (PubChem CID 133460950) has the molecular formula C13H17N5
and a molecular weight of 243.31 g/mol. Its IUPAC name is 6-ethyl-N,2-dimethyl-N-(pyrazin-2-ylmethyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-ethyl-N,2-dimethyl-N-(pyrazin-2-ylmethyl)pyrimidin-4-amine |
| PubChem CID | 133460950 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 6-ethyl-N,2-dimethyl-N-(pyrazin-2-ylmethyl)pyrimidin-4-amine |
| SMILES | CCc1cc(N(C)Cc2cnccn2)nc(C)n1 |
| InChI | InChI=1S/C13H17N5/c1-4-11-7-13(17-10(2)16-11)18(3)9-12-8-14-5-6-15-12/h5-8H,4,9H2,1-3H3 |
| InChIKey | IQDHOCMDUJSUNE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-ethyl-N,2-dimethyl-N-(pyrazin-2-ylmethyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-N,2-dimethyl-N-(pyrazin-2-ylmethyl)pyrimidin-4-amine?
The IUPAC name of 6-ethyl-N,2-dimethyl-N-(pyrazin-2-ylmethyl)pyrimidin-4-amine (CID 133460950) is 6-ethyl-N,2-dimethyl-N-(pyrazin-2-ylmethyl)pyrimidin-4-amine.
What is the SMILES notation for 6-ethyl-N,2-dimethyl-N-(pyrazin-2-ylmethyl)pyrimidin-4-amine?
The canonical SMILES for 6-ethyl-N,2-dimethyl-N-(pyrazin-2-ylmethyl)pyrimidin-4-amine is CCc1cc(N(C)Cc2cnccn2)nc(C)n1.
What is the InChIKey of 6-ethyl-N,2-dimethyl-N-(pyrazin-2-ylmethyl)pyrimidin-4-amine?
The InChIKey is IQDHOCMDUJSUNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N5/c1-4-11-7-13(17-10(2)16-11)18(3)9-12-8-14-5-6-15-12/h5-8H,4,9H2,1-3H3.
What are the key properties of 6-ethyl-N,2-dimethyl-N-(pyrazin-2-ylmethyl)pyrimidin-4-amine?
6-ethyl-N,2-dimethyl-N-(pyrazin-2-ylmethyl)pyrimidin-4-amine has a molecular weight of 243.31 g/mol, XLogP of 1.77, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-N,2-dimethyl-N-(pyrazin-2-ylmethyl)pyrimidin-4-amine is sourced from PubChem (CID 133460950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).