C19H23N5 — CID 133461751
6-ethyl-2-methyl-N-[1-[4-(2-methylimidazol-1-yl)phenyl]ethyl]pyrimidin-4-amine (PubChem CID 133461751) has the molecular formula C19H23N5 and a molecular weight of 321.43 g/mol. Its IUPAC name is 6-ethyl-2-methyl-N-[1-[4-(2-methylimidazol-1-yl)phenyl]ethyl]pyrimidin-4-amine.
| Compound Name | 6-ethyl-2-methyl-N-[1-[4-(2-methylimidazol-1-yl)phenyl]ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133461751 |
| Molecular Formula | C19H23N5 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 6-ethyl-2-methyl-N-[1-[4-(2-methylimidazol-1-yl)phenyl]ethyl]pyrimidin-4-amine |
| SMILES | CCc1cc(NC(C)c2ccc(-n3ccnc3C)cc2)nc(C)n1 |
| InChI | InChI=1S/C19H23N5/c1-5-17-12-19(23-14(3)22-17)21-13(2)16-6-8-18(9-7-16)24-11-10-20-15(24)4/h6-13H,5H2,1-4H3,(H,21,22,23) |
| InChIKey | OVLNSQAFUQKRSL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |