C14H17N5OS — CID 133463120
N-(2-ethoxyethyl)-N-methyl-6-pyridin-3-ylimidazo[2,1-b][1,3,4]thiadiazol-2-amine (PubChem CID 133463120) has the molecular formula C14H17N5OS and a molecular weight of 303.39 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-N-methyl-6-pyridin-3-ylimidazo[2,1-b][1,3,4]thiadiazol-2-amine.
| Compound Name | N-(2-ethoxyethyl)-N-methyl-6-pyridin-3-ylimidazo[2,1-b][1,3,4]thiadiazol-2-amine |
|---|---|
| PubChem CID | 133463120 |
| Molecular Formula | C14H17N5OS |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-(2-ethoxyethyl)-N-methyl-6-pyridin-3-ylimidazo[2,1-b][1,3,4]thiadiazol-2-amine |
| SMILES | CCOCCN(C)c1nn2cc(-c3cccnc3)nc2s1 |
| InChI | InChI=1S/C14H17N5OS/c1-3-20-8-7-18(2)14-17-19-10-12(16-13(19)21-14)11-5-4-6-15-9-11/h4-6,9-10H,3,7-8H2,1-2H3 |
| InChIKey | UYLXWYVDLATQTC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|