C16H20N4 — CID 133463810
6-(3-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)pyrido[2,3-b]pyrazine (PubChem CID 133463810) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 6-(3-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)pyrido[2,3-b]pyrazine.
| Compound Name | 6-(3-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)pyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 133463810 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 6-(3-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)pyrido[2,3-b]pyrazine |
| SMILES | CC1CN(c2ccc3nccnc3n2)C2CCCCC12 |
| InChI | InChI=1S/C16H20N4/c1-11-10-20(14-5-3-2-4-12(11)14)15-7-6-13-16(19-15)18-9-8-17-13/h6-9,11-12,14H,2-5,10H2,1H3 |
| InChIKey | PAXDALHLKMBXML-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |