C13H21N3S — CID 133463957
3-ethyl-5-(3-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,2,4-thiadiazole (PubChem CID 133463957) has the molecular formula C13H21N3S and a molecular weight of 251.40 g/mol. Its IUPAC name is 3-ethyl-5-(3-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,2,4-thiadiazole.
| Compound Name | 3-ethyl-5-(3-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 133463957 |
| Molecular Formula | C13H21N3S |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 3-ethyl-5-(3-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,2,4-thiadiazole |
| SMILES | CCc1nsc(N2CC(C)C3CCCCC32)n1 |
| InChI | InChI=1S/C13H21N3S/c1-3-12-14-13(17-15-12)16-8-9(2)10-6-4-5-7-11(10)16/h9-11H,3-8H2,1-2H3 |
| InChIKey | UTPUPSGTGVRDOE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |