C18H20ClN5O — CID 133464768
3-[4-(5-chloropyrimidin-4-yl)piperazin-1-yl]-1-phenylpyrrolidin-2-one (PubChem CID 133464768) has the molecular formula C18H20ClN5O and a molecular weight of 357.84 g/mol. Its IUPAC name is 3-[4-(5-chloropyrimidin-4-yl)piperazin-1-yl]-1-phenylpyrrolidin-2-one.
| Compound Name | 3-[4-(5-chloropyrimidin-4-yl)piperazin-1-yl]-1-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 133464768 |
| Molecular Formula | C18H20ClN5O |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 3-[4-(5-chloropyrimidin-4-yl)piperazin-1-yl]-1-phenylpyrrolidin-2-one |
| SMILES | O=C1C(N2CCN(c3ncncc3Cl)CC2)CCN1c1ccccc1 |
| InChI | InChI=1S/C18H20ClN5O/c19-15-12-20-13-21-17(15)23-10-8-22(9-11-23)16-6-7-24(18(16)25)14-4-2-1-3-5-14/h1-5,12-13,16H,6-11H2 |
| InChIKey | KNIBEYFTYYXLAO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |