C19H20N4O3 — CID 133464979
2-[4-[(3-methoxyphenyl)methyl]piperidin-1-yl]-3-nitropyridine-4-carbonitrile (PubChem CID 133464979) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-[4-[(3-methoxyphenyl)methyl]piperidin-1-yl]-3-nitropyridine-4-carbonitrile.
| Compound Name | 2-[4-[(3-methoxyphenyl)methyl]piperidin-1-yl]-3-nitropyridine-4-carbonitrile |
|---|---|
| PubChem CID | 133464979 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-[4-[(3-methoxyphenyl)methyl]piperidin-1-yl]-3-nitropyridine-4-carbonitrile |
| SMILES | COc1cccc(CC2CCN(c3nccc(C#N)c3[N+](=O)[O-])CC2)c1 |
| InChI | InChI=1S/C19H20N4O3/c1-26-17-4-2-3-15(12-17)11-14-6-9-22(10-7-14)19-18(23(24)25)16(13-20)5-8-21-19/h2-5,8,12,14H,6-7,9-11H2,1H3 |
| InChIKey | DGIBFEZSGDAQSS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 92.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|