C17H18ClN3O2 — CID 133465286
4-chloro-2-phenyl-5-(3-prop-2-enoxypyrrolidin-1-yl)pyridazin-3-one (PubChem CID 133465286) has the molecular formula C17H18ClN3O2 and a molecular weight of 331.80 g/mol. Its IUPAC name is 4-chloro-2-phenyl-5-(3-prop-2-enoxypyrrolidin-1-yl)pyridazin-3-one.
| Compound Name | 4-chloro-2-phenyl-5-(3-prop-2-enoxypyrrolidin-1-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 133465286 |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 4-chloro-2-phenyl-5-(3-prop-2-enoxypyrrolidin-1-yl)pyridazin-3-one |
| SMILES | C=CCOC1CCN(c2cnn(-c3ccccc3)c(=O)c2Cl)C1 |
| InChI | InChI=1S/C17H18ClN3O2/c1-2-10-23-14-8-9-20(12-14)15-11-19-21(17(22)16(15)18)13-6-4-3-5-7-13/h2-7,11,14H,1,8-10,12H2 |
| InChIKey | NCWNKUHNSYSSEC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|