C16H19N3O2 — CID 133465315
3-(4-methylphenyl)-5-(3-prop-2-enoxypyrrolidin-1-yl)-1,2,4-oxadiazole (PubChem CID 133465315) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 3-(4-methylphenyl)-5-(3-prop-2-enoxypyrrolidin-1-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(4-methylphenyl)-5-(3-prop-2-enoxypyrrolidin-1-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 133465315 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 3-(4-methylphenyl)-5-(3-prop-2-enoxypyrrolidin-1-yl)-1,2,4-oxadiazole |
| SMILES | C=CCOC1CCN(c2nc(-c3ccc(C)cc3)no2)C1 |
| InChI | InChI=1S/C16H19N3O2/c1-3-10-20-14-8-9-19(11-14)16-17-15(18-21-16)13-6-4-12(2)5-7-13/h3-7,14H,1,8-11H2,2H3 |
| InChIKey | NYBBVECERVEOGO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|