C12H19N3OS — CID 133465482
2-propan-2-yl-5-(3-prop-2-enoxypyrrolidin-1-yl)-1,3,4-thiadiazole (PubChem CID 133465482) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-propan-2-yl-5-(3-prop-2-enoxypyrrolidin-1-yl)-1,3,4-thiadiazole.
| Compound Name | 2-propan-2-yl-5-(3-prop-2-enoxypyrrolidin-1-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 133465482 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-propan-2-yl-5-(3-prop-2-enoxypyrrolidin-1-yl)-1,3,4-thiadiazole |
| SMILES | C=CCOC1CCN(c2nnc(C(C)C)s2)C1 |
| InChI | InChI=1S/C12H19N3OS/c1-4-7-16-10-5-6-15(8-10)12-14-13-11(17-12)9(2)3/h4,9-10H,1,5-8H2,2-3H3 |
| InChIKey | YKGAMPPVAZUNTG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|