C17H19N5O — CID 133466059
4-acetyl-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethylamino)benzonitrile (PubChem CID 133466059) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-acetyl-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethylamino)benzonitrile.
| Compound Name | 4-acetyl-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 133466059 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 4-acetyl-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethylamino)benzonitrile |
| SMILES | CC(=O)c1ccc(C#N)cc1NCc1nnc2n1CCCCC2 |
| InChI | InChI=1S/C17H19N5O/c1-12(23)14-7-6-13(10-18)9-15(14)19-11-17-21-20-16-5-3-2-4-8-22(16)17/h6-7,9,19H,2-5,8,11H2,1H3 |
| InChIKey | LURYOPMGBCKJAY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |