About 1-aminopyrrolo[3,4-c]pyridin-3-one
1-aminopyrrolo[3,4-c]pyridin-3-one (PubChem CID 13346795) has the molecular formula C7H5N3O
and a molecular weight of 147.14 g/mol. Its IUPAC name is 1-aminopyrrolo[3,4-c]pyridin-3-one.
Molecular Properties
| Compound Name | 1-aminopyrrolo[3,4-c]pyridin-3-one |
| PubChem CID | 13346795 |
| Molecular Formula | C7H5N3O |
| Molecular Weight | 147.14 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | 1-aminopyrrolo[3,4-c]pyridin-3-one |
| SMILES | NC1=NC(=O)c2cnccc21 |
| InChI | InChI=1S/C7H5N3O/c8-6-4-1-2-9-3-5(4)7(11)10-6/h1-3H,(H2,8,10,11) |
| InChIKey | QMEDJFKNIRUVSD-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.14 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-aminopyrrolo[3,4-c]pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopyrrolo[3,4-c]pyridin-3-one?
The IUPAC name of 1-aminopyrrolo[3,4-c]pyridin-3-one (CID 13346795) is 1-aminopyrrolo[3,4-c]pyridin-3-one.
What is the SMILES notation for 1-aminopyrrolo[3,4-c]pyridin-3-one?
The canonical SMILES for 1-aminopyrrolo[3,4-c]pyridin-3-one is NC1=NC(=O)c2cnccc21.
What is the InChIKey of 1-aminopyrrolo[3,4-c]pyridin-3-one?
The InChIKey is QMEDJFKNIRUVSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O/c8-6-4-1-2-9-3-5(4)7(11)10-6/h1-3H,(H2,8,10,11).
What are the key properties of 1-aminopyrrolo[3,4-c]pyridin-3-one?
1-aminopyrrolo[3,4-c]pyridin-3-one has a molecular weight of 147.14 g/mol, XLogP of -0.06, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopyrrolo[3,4-c]pyridin-3-one is sourced from PubChem (CID 13346795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).