C18H20N4O2 — CID 133468482
4-[[4-(2-oxopiperidin-1-yl)phenyl]methylamino]pyridine-3-carboxamide (PubChem CID 133468482) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 4-[[4-(2-oxopiperidin-1-yl)phenyl]methylamino]pyridine-3-carboxamide.
| Compound Name | 4-[[4-(2-oxopiperidin-1-yl)phenyl]methylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133468482 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 4-[[4-(2-oxopiperidin-1-yl)phenyl]methylamino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnccc1NCc1ccc(N2CCCCC2=O)cc1 |
| InChI | InChI=1S/C18H20N4O2/c19-18(24)15-12-20-9-8-16(15)21-11-13-4-6-14(7-5-13)22-10-2-1-3-17(22)23/h4-9,12H,1-3,10-11H2,(H2,19,24)(H,20,21) |
| InChIKey | WXJBXACIEHZQAM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |