About 6-chloro-2-[[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]methyl]imidazo[1,2-a]pyridine
6-chloro-2-[[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]methyl]imidazo[1,2-a]pyridine (PubChem CID 133468945) has the molecular formula C18H21ClN6
and a molecular weight of 356.86 g/mol. Its IUPAC name is 6-chloro-2-[[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]methyl]imidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 6-chloro-2-[[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]methyl]imidazo[1,2-a]pyridine |
| PubChem CID | 133468945 |
| Molecular Formula | C18H21ClN6 |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 6-chloro-2-[[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]methyl]imidazo[1,2-a]pyridine |
| SMILES | Cc1cnc(C)c(N2CCN(Cc3cn4cc(Cl)ccc4n3)CC2)n1 |
| InChI | InChI=1S/C18H21ClN6/c1-13-9-20-14(2)18(21-13)24-7-5-23(6-8-24)11-16-12-25-10-15(19)3-4-17(25)22-16/h3-4,9-10,12H,5-8,11H2,1-2H3 |
| InChIKey | VDKPLGBZJNSPMN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-chloro-2-[[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]methyl]imidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-[[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]methyl]imidazo[1,2-a]pyridine?
The IUPAC name of 6-chloro-2-[[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]methyl]imidazo[1,2-a]pyridine (CID 133468945) is 6-chloro-2-[[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]methyl]imidazo[1,2-a]pyridine.
What is the SMILES notation for 6-chloro-2-[[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]methyl]imidazo[1,2-a]pyridine?
The canonical SMILES for 6-chloro-2-[[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]methyl]imidazo[1,2-a]pyridine is Cc1cnc(C)c(N2CCN(Cc3cn4cc(Cl)ccc4n3)CC2)n1.
What is the InChIKey of 6-chloro-2-[[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]methyl]imidazo[1,2-a]pyridine?
The InChIKey is VDKPLGBZJNSPMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21ClN6/c1-13-9-20-14(2)18(21-13)24-7-5-23(6-8-24)11-16-12-25-10-15(19)3-4-17(25)22-16/h3-4,9-10,12H,5-8,11H2,1-2H3.
What are the key properties of 6-chloro-2-[[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]methyl]imidazo[1,2-a]pyridine?
6-chloro-2-[[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]methyl]imidazo[1,2-a]pyridine has a molecular weight of 356.86 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-[[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]methyl]imidazo[1,2-a]pyridine is sourced from PubChem (CID 133468945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).