C14H16N4OS — CID 133469453
4-[3-(1,3-thiazol-2-yl)piperidin-1-yl]pyridine-3-carboxamide (PubChem CID 133469453) has the molecular formula C14H16N4OS and a molecular weight of 288.38 g/mol. Its IUPAC name is 4-[3-(1,3-thiazol-2-yl)piperidin-1-yl]pyridine-3-carboxamide.
| Compound Name | 4-[3-(1,3-thiazol-2-yl)piperidin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133469453 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 4-[3-(1,3-thiazol-2-yl)piperidin-1-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnccc1N1CCCC(c2nccs2)C1 |
| InChI | InChI=1S/C14H16N4OS/c15-13(19)11-8-16-4-3-12(11)18-6-1-2-10(9-18)14-17-5-7-20-14/h3-5,7-8,10H,1-2,6,9H2,(H2,15,19) |
| InChIKey | BAYXILLMKZVCRW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |