C15H19N3O — CID 133471206
1-[(3,6-dimethylpyrazin-2-yl)amino]-2-phenylpropan-2-ol (PubChem CID 133471206) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 1-[(3,6-dimethylpyrazin-2-yl)amino]-2-phenylpropan-2-ol.
| Compound Name | 1-[(3,6-dimethylpyrazin-2-yl)amino]-2-phenylpropan-2-ol |
|---|---|
| PubChem CID | 133471206 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 1-[(3,6-dimethylpyrazin-2-yl)amino]-2-phenylpropan-2-ol |
| SMILES | Cc1cnc(C)c(NCC(C)(O)c2ccccc2)n1 |
| InChI | InChI=1S/C15H19N3O/c1-11-9-16-12(2)14(18-11)17-10-15(3,19)13-7-5-4-6-8-13/h4-9,19H,10H2,1-3H3,(H,17,18) |
| InChIKey | ULNFIIULBPGGCR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |