About 11-methyldodeca-1,10-diene
11-methyldodeca-1,10-diene (PubChem CID 13347153) has the molecular formula C13H24
and a molecular weight of 180.33 g/mol. Its IUPAC name is 11-methyldodeca-1,10-diene.
Molecular Properties
| Compound Name | 11-methyldodeca-1,10-diene |
| PubChem CID | 13347153 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 11-methyldodeca-1,10-diene |
| SMILES | C=CCCCCCCCC=C(C)C |
| InChI | InChI=1S/C13H24/c1-4-5-6-7-8-9-10-11-12-13(2)3/h4,12H,1,5-11H2,2-3H3 |
| InChIKey | KYSNRMGJOYWQQR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 11-methyldodeca-1,10-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methyldodeca-1,10-diene?
The IUPAC name of 11-methyldodeca-1,10-diene (CID 13347153) is 11-methyldodeca-1,10-diene.
What is the SMILES notation for 11-methyldodeca-1,10-diene?
The canonical SMILES for 11-methyldodeca-1,10-diene is C=CCCCCCCCC=C(C)C.
What is the InChIKey of 11-methyldodeca-1,10-diene?
The InChIKey is KYSNRMGJOYWQQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24/c1-4-5-6-7-8-9-10-11-12-13(2)3/h4,12H,1,5-11H2,2-3H3.
What are the key properties of 11-methyldodeca-1,10-diene?
11-methyldodeca-1,10-diene has a molecular weight of 180.33 g/mol, XLogP of 4.87, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methyldodeca-1,10-diene is sourced from PubChem (CID 13347153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).