C22H23N3O — CID 133473601
N-(2-cyclopropyloxan-4-yl)-4-phenylquinazolin-2-amine (PubChem CID 133473601) has the molecular formula C22H23N3O and a molecular weight of 345.45 g/mol. Its IUPAC name is N-(2-cyclopropyloxan-4-yl)-4-phenylquinazolin-2-amine.
| Compound Name | N-(2-cyclopropyloxan-4-yl)-4-phenylquinazolin-2-amine |
|---|---|
| PubChem CID | 133473601 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N-(2-cyclopropyloxan-4-yl)-4-phenylquinazolin-2-amine |
| SMILES | c1ccc(-c2nc(NC3CCOC(C4CC4)C3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C22H23N3O/c1-2-6-16(7-3-1)21-18-8-4-5-9-19(18)24-22(25-21)23-17-12-13-26-20(14-17)15-10-11-15/h1-9,15,17,20H,10-14H2,(H,23,24,25) |
| InChIKey | BDJLSDUVJAZLKH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |