C14H19N3O3 — CID 133473769
methyl 6-[(2-cyclopropyloxan-4-yl)amino]pyridazine-3-carboxylate (PubChem CID 133473769) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is methyl 6-[(2-cyclopropyloxan-4-yl)amino]pyridazine-3-carboxylate.
| Compound Name | methyl 6-[(2-cyclopropyloxan-4-yl)amino]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 133473769 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | methyl 6-[(2-cyclopropyloxan-4-yl)amino]pyridazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(NC2CCOC(C3CC3)C2)nn1 |
| InChI | InChI=1S/C14H19N3O3/c1-19-14(18)11-4-5-13(17-16-11)15-10-6-7-20-12(8-10)9-2-3-9/h4-5,9-10,12H,2-3,6-8H2,1H3,(H,15,17) |
| InChIKey | KEYIABPAQKBQMT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |