C16H15BrN2O5S — CID 133473871
N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-3-methylsulfonyl-4-nitroaniline (PubChem CID 133473871) has the molecular formula C16H15BrN2O5S and a molecular weight of 427.28 g/mol. Its IUPAC name is N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-3-methylsulfonyl-4-nitroaniline.
| Compound Name | N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-3-methylsulfonyl-4-nitroaniline |
|---|---|
| PubChem CID | 133473871 |
| Molecular Formula | C16H15BrN2O5S |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-3-methylsulfonyl-4-nitroaniline |
| SMILES | CS(=O)(=O)c1cc(NCc2cc(Br)cc3c2OCC3)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15BrN2O5S/c1-25(22,23)15-8-13(2-3-14(15)19(20)21)18-9-11-7-12(17)6-10-4-5-24-16(10)11/h2-3,6-8,18H,4-5,9H2,1H3 |
| InChIKey | GFIFLYSULBYLCV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|