C19H17F3N2O — CID 133474283
4-[(2-phenyloxan-4-yl)amino]-3-(trifluoromethyl)benzonitrile (PubChem CID 133474283) has the molecular formula C19H17F3N2O and a molecular weight of 346.35 g/mol. Its IUPAC name is 4-[(2-phenyloxan-4-yl)amino]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(2-phenyloxan-4-yl)amino]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 133474283 |
| Molecular Formula | C19H17F3N2O |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 4-[(2-phenyloxan-4-yl)amino]-3-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(NC2CCOC(c3ccccc3)C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17F3N2O/c20-19(21,22)16-10-13(12-23)6-7-17(16)24-15-8-9-25-18(11-15)14-4-2-1-3-5-14/h1-7,10,15,18,24H,8-9,11H2 |
| InChIKey | VOXKBNZDCXFRRQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |