C15H14Cl3N3O3S — CID 133474480
4,5-dichloro-2-[3-chloro-4-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyridazin-3-one (PubChem CID 133474480) has the molecular formula C15H14Cl3N3O3S and a molecular weight of 422.72 g/mol. Its IUPAC name is 4,5-dichloro-2-[3-chloro-4-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-[3-chloro-4-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyridazin-3-one |
|---|---|
| PubChem CID | 133474480 |
| Molecular Formula | C15H14Cl3N3O3S |
| Molecular Weight | 422.72 g/mol |
| Exact Mass | 420.98 |
| IUPAC Name | 4,5-dichloro-2-[3-chloro-4-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyridazin-3-one |
| SMILES | CC1CN(c2ccc(-n3ncc(Cl)c(Cl)c3=O)cc2Cl)CCS1(=O)=O |
| InChI | InChI=1S/C15H14Cl3N3O3S/c1-9-8-20(4-5-25(9,23)24)13-3-2-10(6-11(13)16)21-15(22)14(18)12(17)7-19-21/h2-3,6-7,9H,4-5,8H2,1H3 |
| InChIKey | SNADSFZDTHQXBY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.72 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|