About 5-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]pyridine-2-carbonitrile
5-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]pyridine-2-carbonitrile (PubChem CID 133475245) has the molecular formula C16H17N5O
and a molecular weight of 295.35 g/mol. Its IUPAC name is 5-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 5-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]pyridine-2-carbonitrile |
| PubChem CID | 133475245 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 5-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(N2CCC(c3noc(C4CC4)n3)CC2)cn1 |
| InChI | InChI=1S/C16H17N5O/c17-9-13-3-4-14(10-18-13)21-7-5-11(6-8-21)15-19-16(22-20-15)12-1-2-12/h3-4,10-12H,1-2,5-8H2 |
| InChIKey | NFUOLCPIXFIPJT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 78.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]pyridine-2-carbonitrile?
The IUPAC name of 5-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]pyridine-2-carbonitrile (CID 133475245) is 5-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]pyridine-2-carbonitrile.
What is the SMILES notation for 5-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]pyridine-2-carbonitrile?
The canonical SMILES for 5-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]pyridine-2-carbonitrile is N#Cc1ccc(N2CCC(c3noc(C4CC4)n3)CC2)cn1.
What is the InChIKey of 5-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]pyridine-2-carbonitrile?
The InChIKey is NFUOLCPIXFIPJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N5O/c17-9-13-3-4-14(10-18-13)21-7-5-11(6-8-21)15-19-16(22-20-15)12-1-2-12/h3-4,10-12H,1-2,5-8H2.
What are the key properties of 5-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]pyridine-2-carbonitrile?
5-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]pyridine-2-carbonitrile has a molecular weight of 295.35 g/mol, XLogP of 2.60, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]pyridine-2-carbonitrile is sourced from PubChem (CID 133475245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).