C17H21FN4O2S — CID 133476078
1-[8-fluoro-5-[[3-(2-methoxyethyl)-1,2,4-thiadiazol-5-yl]amino]-1,3,4,5-tetrahydro-2-benzazepin-2-yl]ethanone (PubChem CID 133476078) has the molecular formula C17H21FN4O2S and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-[8-fluoro-5-[[3-(2-methoxyethyl)-1,2,4-thiadiazol-5-yl]amino]-1,3,4,5-tetrahydro-2-benzazepin-2-yl]ethanone.
| Compound Name | 1-[8-fluoro-5-[[3-(2-methoxyethyl)-1,2,4-thiadiazol-5-yl]amino]-1,3,4,5-tetrahydro-2-benzazepin-2-yl]ethanone |
|---|---|
| PubChem CID | 133476078 |
| Molecular Formula | C17H21FN4O2S |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1-[8-fluoro-5-[[3-(2-methoxyethyl)-1,2,4-thiadiazol-5-yl]amino]-1,3,4,5-tetrahydro-2-benzazepin-2-yl]ethanone |
| SMILES | COCCc1nsc(NC2CCN(C(C)=O)Cc3cc(F)ccc32)n1 |
| InChI | InChI=1S/C17H21FN4O2S/c1-11(23)22-7-5-15(14-4-3-13(18)9-12(14)10-22)19-17-20-16(21-25-17)6-8-24-2/h3-4,9,15H,5-8,10H2,1-2H3,(H,19,20,21) |
| InChIKey | FAMVWCMIOICNDP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |