C14H20N4O — CID 133477090
6-[2-(cyclohepten-1-yl)ethylamino]pyridazine-3-carboxamide (PubChem CID 133477090) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 6-[2-(cyclohepten-1-yl)ethylamino]pyridazine-3-carboxamide.
| Compound Name | 6-[2-(cyclohepten-1-yl)ethylamino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 133477090 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 6-[2-(cyclohepten-1-yl)ethylamino]pyridazine-3-carboxamide |
| SMILES | NC(=O)c1ccc(NCCC2=CCCCCC2)nn1 |
| InChI | InChI=1S/C14H20N4O/c15-14(19)12-7-8-13(18-17-12)16-10-9-11-5-3-1-2-4-6-11/h5,7-8H,1-4,6,9-10H2,(H2,15,19)(H,16,18) |
| InChIKey | VITMAOLFHSBPES-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|