C18H15ClFN3O2 — CID 133477281
5-chloro-4-[[4-[(2-fluorophenyl)methoxy]phenyl]methylamino]-1H-pyridazin-6-one (PubChem CID 133477281) has the molecular formula C18H15ClFN3O2 and a molecular weight of 359.79 g/mol. Its IUPAC name is 5-chloro-4-[[4-[(2-fluorophenyl)methoxy]phenyl]methylamino]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-[[4-[(2-fluorophenyl)methoxy]phenyl]methylamino]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 133477281 |
| Molecular Formula | C18H15ClFN3O2 |
| Molecular Weight | 359.79 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 5-chloro-4-[[4-[(2-fluorophenyl)methoxy]phenyl]methylamino]-1H-pyridazin-6-one |
| SMILES | O=c1[nH]ncc(NCc2ccc(OCc3ccccc3F)cc2)c1Cl |
| InChI | InChI=1S/C18H15ClFN3O2/c19-17-16(10-22-23-18(17)24)21-9-12-5-7-14(8-6-12)25-11-13-3-1-2-4-15(13)20/h1-8,10H,9,11H2,(H2,21,23,24) |
| InChIKey | CABCUFKYXSAWOV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.79 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |