C17H15FN6O2S — CID 133477345
2-N-[2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]-5-nitropyrimidine-2,4-diamine (PubChem CID 133477345) has the molecular formula C17H15FN6O2S and a molecular weight of 386.41 g/mol. Its IUPAC name is 2-N-[2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-[2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 133477345 |
| Molecular Formula | C17H15FN6O2S |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2-N-[2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]-5-nitropyrimidine-2,4-diamine |
| SMILES | Nc1nc(NC2CCCc3sc(-c4ccc(F)cc4)nc32)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15FN6O2S/c18-10-6-4-9(5-7-10)16-22-14-11(2-1-3-13(14)27-16)21-17-20-8-12(24(25)26)15(19)23-17/h4-8,11H,1-3H2,(H3,19,20,21,23) |
| InChIKey | IOWCMTCCRMWUNX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|