C19H30N6 — CID 133477612
N-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-6-piperidin-1-ylpyrimidin-4-amine (PubChem CID 133477612) has the molecular formula C19H30N6 and a molecular weight of 342.49 g/mol. Its IUPAC name is N-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-6-piperidin-1-ylpyrimidin-4-amine.
| Compound Name | N-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-6-piperidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133477612 |
| Molecular Formula | C19H30N6 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | N-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-6-piperidin-1-ylpyrimidin-4-amine |
| SMILES | Cc1nn(C(C)(C)C)cc1C(C)Nc1cc(N2CCCCC2)ncn1 |
| InChI | InChI=1S/C19H30N6/c1-14(16-12-25(19(3,4)5)23-15(16)2)22-17-11-18(21-13-20-17)24-9-7-6-8-10-24/h11-14H,6-10H2,1-5H3,(H,20,21,22) |
| InChIKey | UABMIJNKJHYHIJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |