C14H15FN2O2 — CID 133479070
4-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)-3-fluorobenzonitrile (PubChem CID 133479070) has the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. Its IUPAC name is 4-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)-3-fluorobenzonitrile.
| Compound Name | 4-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 133479070 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(N2CCOC3(CCOC3)C2)c(F)c1 |
| InChI | InChI=1S/C14H15FN2O2/c15-12-7-11(8-16)1-2-13(12)17-4-6-19-14(9-17)3-5-18-10-14/h1-2,7H,3-6,9-10H2 |
| InChIKey | BMYRVDQIRUKOIW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |