About 4-acetyl-3-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)benzonitrile
4-acetyl-3-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)benzonitrile (PubChem CID 133479112) has the molecular formula C16H18N2O3
and a molecular weight of 286.33 g/mol. Its IUPAC name is 4-acetyl-3-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)benzonitrile.
Molecular Properties
| Compound Name | 4-acetyl-3-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)benzonitrile |
| PubChem CID | 133479112 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 4-acetyl-3-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)benzonitrile |
| SMILES | CC(=O)c1ccc(C#N)cc1N1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C16H18N2O3/c1-12(19)14-3-2-13(9-17)8-15(14)18-5-7-21-16(10-18)4-6-20-11-16/h2-3,8H,4-7,10-11H2,1H3 |
| InChIKey | LFEIOWODKJLUTC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-acetyl-3-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-3-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)benzonitrile?
The IUPAC name of 4-acetyl-3-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)benzonitrile (CID 133479112) is 4-acetyl-3-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)benzonitrile.
What is the SMILES notation for 4-acetyl-3-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)benzonitrile?
The canonical SMILES for 4-acetyl-3-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)benzonitrile is CC(=O)c1ccc(C#N)cc1N1CCOC2(CCOC2)C1.
What is the InChIKey of 4-acetyl-3-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)benzonitrile?
The InChIKey is LFEIOWODKJLUTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O3/c1-12(19)14-3-2-13(9-17)8-15(14)18-5-7-21-16(10-18)4-6-20-11-16/h2-3,8H,4-7,10-11H2,1H3.
What are the key properties of 4-acetyl-3-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)benzonitrile?
4-acetyl-3-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)benzonitrile has a molecular weight of 286.33 g/mol, XLogP of 1.76, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-3-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)benzonitrile is sourced from PubChem (CID 133479112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).