C18H12 — CID 13347915
tetracyclo[8.8.0.02,6.011,17]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene (PubChem CID 13347915) has the molecular formula C18H12 and a molecular weight of 228.29 g/mol. Its IUPAC name is tetracyclo[8.8.0.02,6.011,17]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene.
| Compound Name | tetracyclo[8.8.0.02,6.011,17]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene |
|---|---|
| PubChem CID | 13347915 |
| Molecular Formula | C18H12 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | tetracyclo[8.8.0.02,6.011,17]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene |
| SMILES | c1ccc2cc3c4cccc4cccc3c2cc1 |
| InChI | InChI=1S/C18H12/c1-2-6-14-12-18-15-10-4-7-13(15)8-5-11-17(18)16(14)9-3-1/h1-12H |
| InChIKey | PSFBIRPHGDQMPH-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azulene(4)', 'substructure': 'N/A'} |
|---|