C12H16N2O2 — CID 133479328
9-pyridin-2-yl-2,6-dioxa-9-azaspiro[4.5]decane (PubChem CID 133479328) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 9-pyridin-2-yl-2,6-dioxa-9-azaspiro[4.5]decane.
| Compound Name | 9-pyridin-2-yl-2,6-dioxa-9-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 133479328 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 9-pyridin-2-yl-2,6-dioxa-9-azaspiro[4.5]decane |
| SMILES | c1ccc(N2CCOC3(CCOC3)C2)nc1 |
| InChI | InChI=1S/C12H16N2O2/c1-2-5-13-11(3-1)14-6-8-16-12(9-14)4-7-15-10-12/h1-3,5H,4,6-10H2 |
| InChIKey | YIZDCGRUOSWSDY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |