C17H14F2N4O2S — CID 133480027
6-[4-[(3,4-difluorophenyl)methylidene]piperidin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole (PubChem CID 133480027) has the molecular formula C17H14F2N4O2S and a molecular weight of 376.39 g/mol. Its IUPAC name is 6-[4-[(3,4-difluorophenyl)methylidene]piperidin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-[4-[(3,4-difluorophenyl)methylidene]piperidin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 133480027 |
| Molecular Formula | C17H14F2N4O2S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 6-[4-[(3,4-difluorophenyl)methylidene]piperidin-1-yl]-5-nitroimidazo[2,1-b][1,3]thiazole |
| SMILES | O=[N+]([O-])c1c(N2CCC(=Cc3ccc(F)c(F)c3)CC2)nc2sccn12 |
| InChI | InChI=1S/C17H14F2N4O2S/c18-13-2-1-12(10-14(13)19)9-11-3-5-21(6-4-11)15-16(23(24)25)22-7-8-26-17(22)20-15/h1-2,7-10H,3-6H2 |
| InChIKey | ZWMAVHFQUITJDQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|