About 4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-6-pyrazol-1-ylpyrimidin-5-amine
4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-6-pyrazol-1-ylpyrimidin-5-amine (PubChem CID 133480564) has the molecular formula C19H20F2N6
and a molecular weight of 370.41 g/mol. Its IUPAC name is 4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-6-pyrazol-1-ylpyrimidin-5-amine.
Molecular Properties
| Compound Name | 4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-6-pyrazol-1-ylpyrimidin-5-amine |
| PubChem CID | 133480564 |
| Molecular Formula | C19H20F2N6 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-6-pyrazol-1-ylpyrimidin-5-amine |
| SMILES | Nc1c(N2CCC(Cc3ccc(F)c(F)c3)CC2)ncnc1-n1cccn1 |
| InChI | InChI=1S/C19H20F2N6/c20-15-3-2-14(11-16(15)21)10-13-4-8-26(9-5-13)18-17(22)19(24-12-23-18)27-7-1-6-25-27/h1-3,6-7,11-13H,4-5,8-10,22H2 |
| InChIKey | SUFRNIXCEKJIDA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-6-pyrazol-1-ylpyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-6-pyrazol-1-ylpyrimidin-5-amine?
The IUPAC name of 4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-6-pyrazol-1-ylpyrimidin-5-amine (CID 133480564) is 4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-6-pyrazol-1-ylpyrimidin-5-amine.
What is the SMILES notation for 4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-6-pyrazol-1-ylpyrimidin-5-amine?
The canonical SMILES for 4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-6-pyrazol-1-ylpyrimidin-5-amine is Nc1c(N2CCC(Cc3ccc(F)c(F)c3)CC2)ncnc1-n1cccn1.
What is the InChIKey of 4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-6-pyrazol-1-ylpyrimidin-5-amine?
The InChIKey is SUFRNIXCEKJIDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20F2N6/c20-15-3-2-14(11-16(15)21)10-13-4-8-26(9-5-13)18-17(22)19(24-12-23-18)27-7-1-6-25-27/h1-3,6-7,11-13H,4-5,8-10,22H2.
What are the key properties of 4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-6-pyrazol-1-ylpyrimidin-5-amine?
4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-6-pyrazol-1-ylpyrimidin-5-amine has a molecular weight of 370.41 g/mol, XLogP of 2.98, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-6-pyrazol-1-ylpyrimidin-5-amine is sourced from PubChem (CID 133480564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).