About 3-bromo-8-(4-phenyl-1,4-diazepan-1-yl)-1,5-naphthyridine
3-bromo-8-(4-phenyl-1,4-diazepan-1-yl)-1,5-naphthyridine (PubChem CID 133482284) has the molecular formula C19H19BrN4
and a molecular weight of 383.29 g/mol. Its IUPAC name is 3-bromo-8-(4-phenyl-1,4-diazepan-1-yl)-1,5-naphthyridine.
Molecular Properties
| Compound Name | 3-bromo-8-(4-phenyl-1,4-diazepan-1-yl)-1,5-naphthyridine |
| PubChem CID | 133482284 |
| Molecular Formula | C19H19BrN4 |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 3-bromo-8-(4-phenyl-1,4-diazepan-1-yl)-1,5-naphthyridine |
| SMILES | Brc1cnc2c(N3CCCN(c4ccccc4)CC3)ccnc2c1 |
| InChI | InChI=1S/C19H19BrN4/c20-15-13-17-19(22-14-15)18(7-8-21-17)24-10-4-9-23(11-12-24)16-5-2-1-3-6-16/h1-3,5-8,13-14H,4,9-12H2 |
| InChIKey | KASOUXATIFFQTD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-8-(4-phenyl-1,4-diazepan-1-yl)-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-8-(4-phenyl-1,4-diazepan-1-yl)-1,5-naphthyridine?
The IUPAC name of 3-bromo-8-(4-phenyl-1,4-diazepan-1-yl)-1,5-naphthyridine (CID 133482284) is 3-bromo-8-(4-phenyl-1,4-diazepan-1-yl)-1,5-naphthyridine.
What is the SMILES notation for 3-bromo-8-(4-phenyl-1,4-diazepan-1-yl)-1,5-naphthyridine?
The canonical SMILES for 3-bromo-8-(4-phenyl-1,4-diazepan-1-yl)-1,5-naphthyridine is Brc1cnc2c(N3CCCN(c4ccccc4)CC3)ccnc2c1.
What is the InChIKey of 3-bromo-8-(4-phenyl-1,4-diazepan-1-yl)-1,5-naphthyridine?
The InChIKey is KASOUXATIFFQTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19BrN4/c20-15-13-17-19(22-14-15)18(7-8-21-17)24-10-4-9-23(11-12-24)16-5-2-1-3-6-16/h1-3,5-8,13-14H,4,9-12H2.
What are the key properties of 3-bromo-8-(4-phenyl-1,4-diazepan-1-yl)-1,5-naphthyridine?
3-bromo-8-(4-phenyl-1,4-diazepan-1-yl)-1,5-naphthyridine has a molecular weight of 383.29 g/mol, XLogP of 4.11, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-8-(4-phenyl-1,4-diazepan-1-yl)-1,5-naphthyridine is sourced from PubChem (CID 133482284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).