About 2-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]-N-tert-butylbenzenesulfonamide
2-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]-N-tert-butylbenzenesulfonamide (PubChem CID 133482451) has the molecular formula C19H21BrN4O2S
and a molecular weight of 449.37 g/mol. Its IUPAC name is 2-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]-N-tert-butylbenzenesulfonamide.
Molecular Properties
| Compound Name | 2-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]-N-tert-butylbenzenesulfonamide |
| PubChem CID | 133482451 |
| Molecular Formula | C19H21BrN4O2S |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 2-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]-N-tert-butylbenzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccccc1CNc1ccnc2cc(Br)cnc12 |
| InChI | InChI=1S/C19H21BrN4O2S/c1-19(2,3)24-27(25,26)17-7-5-4-6-13(17)11-22-15-8-9-21-16-10-14(20)12-23-18(15)16/h4-10,12,24H,11H2,1-3H3,(H,21,22) |
| InChIKey | OEUOBCHGTHQTHI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]-N-tert-butylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]-N-tert-butylbenzenesulfonamide?
The IUPAC name of 2-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]-N-tert-butylbenzenesulfonamide (CID 133482451) is 2-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]-N-tert-butylbenzenesulfonamide.
What is the SMILES notation for 2-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]-N-tert-butylbenzenesulfonamide?
The canonical SMILES for 2-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]-N-tert-butylbenzenesulfonamide is CC(C)(C)NS(=O)(=O)c1ccccc1CNc1ccnc2cc(Br)cnc12.
What is the InChIKey of 2-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]-N-tert-butylbenzenesulfonamide?
The InChIKey is OEUOBCHGTHQTHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21BrN4O2S/c1-19(2,3)24-27(25,26)17-7-5-4-6-13(17)11-22-15-8-9-21-16-10-14(20)12-23-18(15)16/h4-10,12,24H,11H2,1-3H3,(H,21,22).
What are the key properties of 2-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]-N-tert-butylbenzenesulfonamide?
2-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]-N-tert-butylbenzenesulfonamide has a molecular weight of 449.37 g/mol, XLogP of 4.08, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]-N-tert-butylbenzenesulfonamide is sourced from PubChem (CID 133482451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).